| Name |
N-[(3-chloro-4-fluorophenyl)methyl]-2-{2,4-dioxo-3-propyl-1H,2H,3H,4H-thieno[3,2-d]pyrimidin-1-yl}acetamide
|
| Molecular Formula |
C18H18ClFN3O3S+
|
| Molecular Weight |
410.9
|
| Smiles |
CCCN1C(=O)C2SC=CC2=[N+](CC(=O)NCc2ccc(F)c(Cl)c2)C1=O
|
CCCN1C(=O)C2SC=CC2=[N+](CC(=O)NCc2ccc(F)c(Cl)c2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.