| Name |
Sodium 2-[4-(naphthalen-1-yl)-1,3-thiazol-2-yl]acetate
|
| Molecular Formula |
C15H10NNaO2S
|
| Molecular Weight |
291.30
|
| Smiles |
O=C([O-])Cc1nc(-c2cccc3ccccc23)cs1.[Na+]
|
O=C([O-])Cc1nc(-c2cccc3ccccc23)cs1.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.