| Name |
5-[(3,4-Dimethylphenyl)methyl]-2-(4-fluorophenyl)-1,2,3,3a-tetrahydropyrazolo[1,5-d][1,2,4]triazin-4-one
|
| Molecular Formula |
C20H21FN4O
|
| Molecular Weight |
352.4
|
| Smiles |
Cc1ccc(CN2N=CN3NC(c4ccc(F)cc4)CC3C2=O)cc1C
|
Cc1ccc(CN2N=CN3NC(c4ccc(F)cc4)CC3C2=O)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.