| Name |
(6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine dihydrochloride
|
| Molecular Formula |
C12H20Cl2N2O2
|
| Molecular Weight |
295.20
|
| Smiles |
COc1cc2c(cc1OC)C(CN)NCC2.Cl.Cl
|
COc1cc2c(cc1OC)C(CN)NCC2.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.