| Name |
N-(4-chlorophenyl)-2-{5-[(4-fluorophenyl)methyl]-4,6-dioxo-8-thia-3,5-diazatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),10,12-tetraen-3-yl}acetamide
|
| Molecular Formula |
C25H18ClFN3O3S+
|
| Molecular Weight |
494.9
|
| Smiles |
O=C(C[N+]1=C2c3ccccc3SC2C(=O)N(Cc2ccc(F)cc2)C1=O)Nc1ccc(Cl)cc1
|
O=C(C[N+]1=C2c3ccccc3SC2C(=O)N(Cc2ccc(F)cc2)C1=O)Nc1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.