| Name |
Spiro[piperidine-3,2'-pyrano[3,2-b]pyridin]-4'(3'H)-one
|
| Molecular Formula |
C12H14N2O2
|
| Molecular Weight |
218.25
|
| Smiles |
O=C1CC2(CCCNC2)Oc2cccnc21
|
O=C1CC2(CCCNC2)Oc2cccnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.