| Name |
3-(4-Fluorobenzyl)-3'-phenyl-5,5'-bi-1,2,4-oxadiazole
|
| Molecular Formula |
C17H11FN4O2
|
| Molecular Weight |
322.29
|
| Smiles |
Fc1ccc(Cc2noc(-c3nc(-c4ccccc4)no3)n2)cc1
|
Fc1ccc(Cc2noc(-c3nc(-c4ccccc4)no3)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.