| Name |
3-(3-Bromophenyl)-3'-pyridin-4-yl-5,5'-bi-1,2,4-oxadiazole
|
| Molecular Formula |
C15H8BrN5O2
|
| Molecular Weight |
370.16
|
| Smiles |
Brc1cccc(-c2noc(-c3nc(-c4ccncc4)no3)n2)c1
|
Brc1cccc(-c2noc(-c3nc(-c4ccncc4)no3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.