| Name |
[1,1a(2)-Biphenyl]-4,4a(2)-dimethanamine, N4,N4a(2)-dimethyl-
|
| Molecular Formula |
C16H20N2
|
| Molecular Weight |
240.34
|
| Smiles |
CNCc1ccc(-c2ccc(CNC)cc2)cc1
|
CNCc1ccc(-c2ccc(CNC)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.