| Name |
Ethyl 3-(6-methyl-3,4-dioxo-2-phenyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridin-5-yl)propanoate
|
| Molecular Formula |
C18H23N3O4
|
| Molecular Weight |
345.4
|
| Smiles |
CCOC(=O)CCC1C(=O)C2C(=O)N(c3ccccc3)NC2NC1C
|
CCOC(=O)CCC1C(=O)C2C(=O)N(c3ccccc3)NC2NC1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.