| Name |
Di-tert-butyl (4S)-4-{3-[(2-naphthylsulfonyl)oxy]propyl}-N-trityl-L-glutamate
|
| Molecular Formula |
C45H51NO7S
|
| Molecular Weight |
750.0
|
| Smiles |
CC(C)(C)OC(=O)C(CCCOS(=O)(=O)c1ccc2ccccc2c1)CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C
|
CC(C)(C)OC(=O)C(CCCOS(=O)(=O)c1ccc2ccccc2c1)CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.