| Name |
2-[6-(4-Chlorophenyl)-4-methyl-1,3-dioxo-7-phenyl-4a,9a-dihydropurino[7,8-a]imidazol-2-yl]acetic acid
|
| Molecular Formula |
C22H18ClN5O4
|
| Molecular Weight |
451.9
|
| Smiles |
CN1C(=O)N(CC(=O)O)C(=O)C2C1N=C1N(c3ccc(Cl)cc3)C(c3ccccc3)=CN12
|
CN1C(=O)N(CC(=O)O)C(=O)C2C1N=C1N(c3ccc(Cl)cc3)C(c3ccccc3)=CN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.