| Name |
1-[2-(3-chloroanilino)ethyl]-7,9-dimethyl-3-phenyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione
|
| Molecular Formula |
C23H26ClN7O2
|
| Molecular Weight |
467.9
|
| Smiles |
CN1C(=O)C2C(NC3N(CCNc4cccc(Cl)c4)N=C(c4ccccc4)CN23)N(C)C1=O
|
CN1C(=O)C2C(NC3N(CCNc4cccc(Cl)c4)N=C(c4ccccc4)CN23)N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.