| Name |
1,4,5,6,7,8-Hexahydropyrazolo[3,4-d]azepin-3-ol dihydrochloride
|
| Molecular Formula |
C7H13Cl2N3O
|
| Molecular Weight |
226.10
|
| Smiles |
Cl.Cl.O=c1[nH][nH]c2c1CCNCC2
|
Cl.Cl.O=c1[nH][nH]c2c1CCNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.