| Name |
4-(furan-2-ylmethyl)-9-methyl-5,6,6a,8,9,10,10a,10b-octahydro-4aH-pyrimido[4,5-c]isoquinoline-1,3,7-trione
|
| Molecular Formula |
C17H21N3O4
|
| Molecular Weight |
331.4
|
| Smiles |
CC1CC(=O)C2CNC3C(C(=O)NC(=O)N3Cc3ccco3)C2C1
|
CC1CC(=O)C2CNC3C(C(=O)NC(=O)N3Cc3ccco3)C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.