| Name |
1-(3-chlorophenyl)-7-methyl-2-(6-methylpyridin-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione
|
| Molecular Formula |
C24H23ClN2O3
|
| Molecular Weight |
422.9
|
| Smiles |
Cc1cccc(N2C(=O)C3=C(C(=O)C4CC(C)CCC4O3)C2c2cccc(Cl)c2)n1
|
Cc1cccc(N2C(=O)C3=C(C(=O)C4CC(C)CCC4O3)C2c2cccc(Cl)c2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.