| Name |
N-(2-(4-cyclopropyl-5-oxo-3-(thiophen-2-yl)-4,5-dihydro-1H-1,2,4-triazol-1-yl)ethyl)benzofuran-2-carboxamide
|
| Molecular Formula |
C20H18N4O3S
|
| Molecular Weight |
394.4
|
| Smiles |
O=C(NCCn1nc(-c2cccs2)n(C2CC2)c1=O)c1cc2ccccc2o1
|
O=C(NCCn1nc(-c2cccs2)n(C2CC2)c1=O)c1cc2ccccc2o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.