| Name |
1-[7-(2-Chlorophenyl)-1,4-thiazepan-4-yl]-3,3,3-trifluoropropan-1-one
|
| Molecular Formula |
C14H15ClF3NOS
|
| Molecular Weight |
337.8
|
| Smiles |
O=C(CC(F)(F)F)N1CCSC(c2ccccc2Cl)CC1
|
O=C(CC(F)(F)F)N1CCSC(c2ccccc2Cl)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.