| Name |
(1I(2),3I(2),16I+/-)-1,3,16-Trihydroxyolean-12-en-28-oic acid
|
| Molecular Formula |
C30H48O5
|
| Molecular Weight |
488.7
|
| Smiles |
CC1(C)CCC2(C(=O)O)C(O)CC3(C)C(=CCC4C5(C)C(O)CC(O)C(C)(C)C5CCC43C)C2C1
|
CC1(C)CCC2(C(=O)O)C(O)CC3(C)C(=CCC4C5(C)C(O)CC(O)C(C)(C)C5CCC43C)C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.