| Name |
N-(3,4-dichlorophenyl)-2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,7a-dihydrothieno[3,2-d]pyrimidin-1-yl]acetamide
|
| Molecular Formula |
C21H16Cl2FN3O3S
|
| Molecular Weight |
480.3
|
| Smiles |
O=C(CN1C(=O)N(Cc2ccc(F)cc2)C(=O)C2SC=CC21)Nc1ccc(Cl)c(Cl)c1
|
O=C(CN1C(=O)N(Cc2ccc(F)cc2)C(=O)C2SC=CC21)Nc1ccc(Cl)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.