| Name |
2-{3-[(3,4-dimethylphenyl)methyl]-2,4-dioxo-1H,2H,3H,4H-thieno[3,2-d]pyrimidin-1-yl}-N,N-diethylacetamide
|
| Molecular Formula |
C21H26N3O3S+
|
| Molecular Weight |
400.5
|
| Smiles |
CCN(CC)C(=O)C[N+]1=C2C=CSC2C(=O)N(Cc2ccc(C)c(C)c2)C1=O
|
CCN(CC)C(=O)C[N+]1=C2C=CSC2C(=O)N(Cc2ccc(C)c(C)c2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.