| Name |
4-Methyl-1-{2-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl}piperidine
|
| Molecular Formula |
C20H32BNO3
|
| Molecular Weight |
345.3
|
| Smiles |
CC1CCN(CCOc2cccc(B3OC(C)(C)C(C)(C)O3)c2)CC1
|
CC1CCN(CCOc2cccc(B3OC(C)(C)C(C)(C)O3)c2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.