| Name |
Ethyl 6-amino-2,3,4-trimethoxybenzoate hydrochloride
|
| Molecular Formula |
C12H18ClNO5
|
| Molecular Weight |
291.73
|
| Smiles |
CCOC(=O)c1c(N)cc(OC)c(OC)c1OC.Cl
|
CCOC(=O)c1c(N)cc(OC)c(OC)c1OC.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.