| Name |
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-6-yl)-2-[2-[(5-chloropyridin-2-yl)amino]-1,3-thiazol-4-yl]acetamide
|
| Molecular Formula |
C17H21ClN6OS
|
| Molecular Weight |
392.9
|
| Smiles |
O=C(Cc1csc(Nc2ccc(Cl)cn2)n1)NC1CCC2CNNC2C1
|
O=C(Cc1csc(Nc2ccc(Cl)cn2)n1)NC1CCC2CNNC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.