| Name |
L-Alanyl-N~5~-(diaminomethylidene)-L-ornithyl-L-tryptophyl-L-lysyl-L-serylglycyl-L-leucylglycyl-L-proline
|
| Molecular Formula |
C44H70N14O11
|
| Molecular Weight |
971.1
|
| Smiles |
CC(C)CC(NC(=O)CNC(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCN=C(N)N)NC(=O)C(C)N)C(=O)NCC(=O)N1CCCC1C(=O)O
|
CC(C)CC(NC(=O)CNC(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCN=C(N)N)NC(=O)C(C)N)C(=O)NCC(=O)N1CCCC1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.