| Name |
2-Amino-3-(2-fluoro-4,5-dihydroxyphenyl)propanoic acid;hydrobromide
|
| Molecular Formula |
C9H11BrFNO4
|
| Molecular Weight |
296.09
|
| Smiles |
Br.NC(Cc1cc(O)c(O)cc1F)C(=O)O
|
Br.NC(Cc1cc(O)c(O)cc1F)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.