| Name |
9-(3-methoxyphenyl)-1,7-dimethyl-3-(3-phenylpropyl)-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione
|
| Molecular Formula |
C26H33N5O3
|
| Molecular Weight |
463.6
|
| Smiles |
COc1cccc(N2CC(C)CN3C4C(=O)N(CCCc5ccccc5)C(=O)N(C)C4NC23)c1
|
COc1cccc(N2CC(C)CN3C4C(=O)N(CCCc5ccccc5)C(=O)N(C)C4NC23)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.