| Name |
2-[1-(1-methyl-1H-1,2,4-triazol-5-yl)ethyl]-2,3-dihydro-1H-isoindole-1,3-dione
|
| Molecular Formula |
C13H12N4O2
|
| Molecular Weight |
256.26
|
| Smiles |
CC(c1ncnn1C)N1C(=O)c2ccccc2C1=O
|
CC(c1ncnn1C)N1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.