| Name |
N-(4-acetylphenyl)-2-{3-[(4-fluorophenyl)methyl]-2,4-dioxo-1H,2H,3H,4H-thieno[3,2-d]pyrimidin-1-yl}acetamide
|
| Molecular Formula |
C23H20FN3O4S
|
| Molecular Weight |
453.5
|
| Smiles |
CC(=O)c1ccc(NC(=O)CN2C(=O)N(Cc3ccc(F)cc3)C(=O)C3SC=CC32)cc1
|
CC(=O)c1ccc(NC(=O)CN2C(=O)N(Cc3ccc(F)cc3)C(=O)C3SC=CC32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.