| Name |
2-{3-butyl-2,4-dioxo-1H,2H,3H,4H-thieno[3,2-d]pyrimidin-1-yl}-N-(3-chlorophenyl)-N-methylacetamide
|
| Molecular Formula |
C19H21ClN3O3S+
|
| Molecular Weight |
406.9
|
| Smiles |
CCCCN1C(=O)C2SC=CC2=[N+](CC(=O)N(C)c2cccc(Cl)c2)C1=O
|
CCCCN1C(=O)C2SC=CC2=[N+](CC(=O)N(C)c2cccc(Cl)c2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.