| Name |
3-(1,3-benzodioxol-5-ylmethyl)-2-sulfanylidene-4a,5,6,7,8,8a-hexahydro-1H-pyrido[2,3-d]pyrimidin-4-one
|
| Molecular Formula |
C15H17N3O3S
|
| Molecular Weight |
319.4
|
| Smiles |
O=C1C2CCCNC2NC(=S)N1Cc1ccc2c(c1)OCO2
|
O=C1C2CCCNC2NC(=S)N1Cc1ccc2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.