| Name |
4-(3-bromophenyl)-2,4-dihydro-3H-1,2,4-triazol-3-one
|
| Molecular Formula |
C8H6BrN3O
|
| Molecular Weight |
240.06
|
| Smiles |
O=c1[nH]ncn1-c1cccc(Br)c1
|
O=c1[nH]ncn1-c1cccc(Br)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.