| Name |
3-[6-oxo-6-(1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)hexyl]-1,2,3-benzotriazin-4(3H)-one
|
| Molecular Formula |
C24H25N5O2
|
| Molecular Weight |
415.5
|
| Smiles |
O=C(CCCCCn1nnc2ccccc2c1=O)N1CCc2[nH]c3ccccc3c2C1
|
O=C(CCCCCn1nnc2ccccc2c1=O)N1CCc2[nH]c3ccccc3c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.