| Name |
methyl 5-benzyl-2-{[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)acetyl]amino}-1,3-thiazole-4-carboxylate
|
| Molecular Formula |
C21H17N5O4S
|
| Molecular Weight |
435.5
|
| Smiles |
COC(=O)c1nc(NC(=O)Cn2nnc3ccccc3c2=O)sc1Cc1ccccc1
|
COC(=O)c1nc(NC(=O)Cn2nnc3ccccc3c2=O)sc1Cc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.