| Name |
2-((3aS,4S,6S,7aR)-3a,5,5-Trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)pyrrolidine hydrochloride
|
| Molecular Formula |
C14H25BClNO2
|
| Molecular Weight |
285.62
|
| Smiles |
CC1(C)C2CC3OB(C4CCCN4)OC3(C)C1C2.Cl
|
CC1(C)C2CC3OB(C4CCCN4)OC3(C)C1C2.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.