| Name |
methyl 4-(2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl)benzoate
|
| Molecular Formula |
C15H14N2O3
|
| Molecular Weight |
270.28
|
| Smiles |
COC(=O)c1ccc(-c2ccc3c(n2)OCCN3)cc1
|
COC(=O)c1ccc(-c2ccc3c(n2)OCCN3)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.