| Name |
(4-Bromo-phenyl)-(4,4-difluoro-piperidin-1-yl)-methanone
|
| Molecular Formula |
C12H12BrF2NO
|
| Molecular Weight |
304.13
|
| Smiles |
O=C(c1ccc(Br)cc1)N1CCC(F)(F)CC1
|
O=C(c1ccc(Br)cc1)N1CCC(F)(F)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.