| Name |
5-((3,5-Dimethoxyphenylamino)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione
|
| Molecular Formula |
C15H17NO6
|
| Molecular Weight |
307.30
|
| Smiles |
COc1cc(NC=C2C(=O)OC(C)(C)OC2=O)cc(OC)c1
|
COc1cc(NC=C2C(=O)OC(C)(C)OC2=O)cc(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.