| Name |
4H-Pyrazolo[3,4-d]pyrimidin-4-one, 5-(2-azidoethyl)-1,5-dihydro-1-methyl-
|
| Molecular Formula |
C8H9N7O
|
| Molecular Weight |
219.20
|
| Smiles |
Cn1ncc2c(=O)n(CCN=[N+]=[N-])cnc21
|
Cn1ncc2c(=O)n(CCN=[N+]=[N-])cnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.