| Name |
L-Phenylalanine, N-[[2-(6-benzofuranylcarbonyl)-5,7-dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl]carbonyl]-2-chloro-5-(methylsulfonyl)-
|
| Molecular Formula |
C29H23Cl3N2O7S
|
| Molecular Weight |
649.9
|
| Smiles |
CS(=O)(=O)c1ccc(Cl)c(CC(NC(=O)c2c(Cl)cc3c(c2Cl)CCN(C(=O)c2ccc4ccoc4c2)C3)C(=O)O)c1
|
CS(=O)(=O)c1ccc(Cl)c(CC(NC(=O)c2c(Cl)cc3c(c2Cl)CCN(C(=O)c2ccc4ccoc4c2)C3)C(=O)O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.