| Name |
12-Chloro-10-(2,2-dimethylpropyl)-7-thia-9,11-diazatricyclo[6.4.0.0,2,6]dodeca-1(12),2(6),8,10-tetraene
|
| Molecular Formula |
C14H17ClN2S
|
| Molecular Weight |
280.8
|
| Smiles |
CC(C)(C)Cc1nc(Cl)c2c3c(sc2n1)CCC3
|
CC(C)(C)Cc1nc(Cl)c2c3c(sc2n1)CCC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.