| Name |
2-Amino-6-(2,2,2-trifluoroethyl)benzoic acid
|
| Molecular Formula |
C9H8F3NO2
|
| Molecular Weight |
219.16
|
| Smiles |
Nc1cccc(CC(F)(F)F)c1C(=O)O
|
Nc1cccc(CC(F)(F)F)c1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.