| Name |
1-(3,5-Dimethylbenzyl)-1h-1,2,4-triazol-3-amine
|
| Molecular Formula |
C11H14N4
|
| Molecular Weight |
202.26
|
| Smiles |
Cc1cc(C)cc(Cn2cnc(N)n2)c1
|
Cc1cc(C)cc(Cn2cnc(N)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.