| Name |
N-(5-iodopyridin-2-yl)-1,4-dioxane-2-carboxamide
|
| Molecular Formula |
C10H11IN2O3
|
| Molecular Weight |
334.11
|
| Smiles |
O=C(Nc1ccc(I)cn1)C1COCCO1
|
O=C(Nc1ccc(I)cn1)C1COCCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.