| Name |
4-Iodo-2-methoxy-5-{[(triisopropylsilyl)oxy]methyl}pyridine
|
| Molecular Formula |
C16H28INO2Si
|
| Molecular Weight |
421.39
|
| Smiles |
COc1cc(I)c(CO[Si](C(C)C)(C(C)C)C(C)C)cn1
|
COc1cc(I)c(CO[Si](C(C)C)(C(C)C)C(C)C)cn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.