| Name |
1H-Inden-1-ol, 5-[[(1,1-diMethylethyl)diMethylsilyl]oxy]-2,3-dihydro-1-Methyl-
|
| Molecular Formula |
C16H26O2Si
|
| Molecular Weight |
278.46
|
| Smiles |
CC1(O)CCc2cc(O[Si](C)(C)C(C)(C)C)ccc21
|
CC1(O)CCc2cc(O[Si](C)(C)C(C)(C)C)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.