| Name |
3-(4,5-Dimethyl-4h-1,2,4-triazol-3-yl)-4,5-dimethylaniline
|
| Molecular Formula |
C12H16N4
|
| Molecular Weight |
216.28
|
| Smiles |
Cc1cc(N)cc(-c2nnc(C)n2C)c1C
|
Cc1cc(N)cc(-c2nnc(C)n2C)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.