| Name |
N-(1,4-dihydro-4-oxothieno[2,3-d]pyrimidin-2-yl)-2,2-dimethylpropanamide
|
| Molecular Formula |
C11H13N3O2S
|
| Molecular Weight |
251.31
|
| Smiles |
CC(C)(C)C(=O)Nc1nc2sccc2c(=O)[nH]1
|
CC(C)(C)C(=O)Nc1nc2sccc2c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.