| Name |
4-[4-(3-Hydroxypropyl)phenyl]-5,5-dimethyl-5,6-dihydro-2H-pyridine-1,3-dicarboxylic acid 1-tert-butyl ester 3-methyl ester
|
| Molecular Formula |
C23H33NO5
|
| Molecular Weight |
403.5
|
| Smiles |
COC(=O)C1=C(c2ccc(CCCO)cc2)C(C)(C)CN(C(=O)OC(C)(C)C)C1
|
COC(=O)C1=C(c2ccc(CCCO)cc2)C(C)(C)CN(C(=O)OC(C)(C)C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.