| Name |
1-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[3,4-b]pyridine
|
| Molecular Formula |
C18H19BFN3O2
|
| Molecular Weight |
339.2
|
| Smiles |
CC1(C)OB(c2ccnc3c2cnn3-c2ccc(F)cc2)OC1(C)C
|
CC1(C)OB(c2ccnc3c2cnn3-c2ccc(F)cc2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.